C23H18ClN5O2S — CID 25107505
(4S)-5-(4-chlorophenyl)-N'-(4-cyanophenyl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 25107505) has the molecular formula C23H18ClN5O2S and a molecular weight of 463.95 g/mol. Its IUPAC name is (4S)-5-(4-chlorophenyl)-N'-(4-cyanophenyl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | (4S)-5-(4-chlorophenyl)-N'-(4-cyanophenyl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 25107505 |
| Molecular Formula | C23H18ClN5O2S |
| Molecular Weight | 463.95 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | (4S)-5-(4-chlorophenyl)-N'-(4-cyanophenyl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | N#Cc1ccc(S(=O)(=O)/N=C(\N)N2C[C@H](c3ccccc3)C(c3ccc(Cl)cc3)=N2)cc1 |
| InChI | InChI=1S/C23H18ClN5O2S/c24-19-10-8-18(9-11-19)22-21(17-4-2-1-3-5-17)15-29(27-22)23(26)28-32(30,31)20-12-6-16(14-25)7-13-20/h1-13,21H,15H2,(H2,26,28)/t21-/m1/s1 |
| InChIKey | OQIBXTHHXDTIBJ-OAQYLSRUSA-N |
| XLogP | 3.72 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.95 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|