C31H27ClN4O5S — CID 46832664
4-[[4-[[C-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-methylcarbonimidoyl]sulfamoyl]phenoxy]methyl]benzoic acid (PubChem CID 46832664) has the molecular formula C31H27ClN4O5S and a molecular weight of 603.10 g/mol. Its IUPAC name is 4-[[4-[[C-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-methylcarbonimidoyl]sulfamoyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[[C-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-methylcarbonimidoyl]sulfamoyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 46832664 |
| Molecular Formula | C31H27ClN4O5S |
| Molecular Weight | 603.10 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | 4-[[4-[[C-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-methylcarbonimidoyl]sulfamoyl]phenoxy]methyl]benzoic acid |
| SMILES | C/N=C(/NS(=O)(=O)c1ccc(OCc2ccc(C(=O)O)cc2)cc1)N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C31H27ClN4O5S/c1-33-31(36-19-28(22-5-3-2-4-6-22)29(34-36)23-11-13-25(32)14-12-23)35-42(39,40)27-17-15-26(16-18-27)41-20-21-7-9-24(10-8-21)30(37)38/h2-18,28H,19-20H2,1H3,(H,33,35)(H,37,38) |
| InChIKey | VGRYSMCUCNAEMD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.10 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|