C29H32Cl2N6O4S2 — CID 169235649
(4S)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-N'-[2-(4-methylpiperazin-1-yl)sulfonylethyl]-4-phenyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 169235649) has the molecular formula C29H32Cl2N6O4S2 and a molecular weight of 663.65 g/mol. Its IUPAC name is (4S)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-N'-[2-(4-methylpiperazin-1-yl)sulfonylethyl]-4-phenyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | (4S)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-N'-[2-(4-methylpiperazin-1-yl)sulfonylethyl]-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 169235649 |
| Molecular Formula | C29H32Cl2N6O4S2 |
| Molecular Weight | 663.65 g/mol |
| Exact Mass | 662.13 |
| IUPAC Name | (4S)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-N'-[2-(4-methylpiperazin-1-yl)sulfonylethyl]-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CN1CCN(S(=O)(=O)CC/N=C(/NS(=O)(=O)c2ccc(Cl)cc2)N2C[C@H](c3ccccc3)C(c3ccc(Cl)cc3)=N2)CC1 |
| InChI | InChI=1S/C29H32Cl2N6O4S2/c1-35-16-18-36(19-17-35)42(38,39)20-15-32-29(34-43(40,41)26-13-11-25(31)12-14-26)37-21-27(22-5-3-2-4-6-22)28(33-37)23-7-9-24(30)10-8-23/h2-14,27H,15-21H2,1H3,(H,32,34)/t27-/m1/s1 |
| InChIKey | WGMAYMHCDLPRJG-HHHXNRCGSA-N |
| XLogP | 3.71 |
| TPSA | 114.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.65 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|