C23H28ClN5O3S — CID 22267396
5-(4-chlorophenyl)-N'-(2-hydroxyethyl)-4-phenyl-N-piperidin-1-ylsulfonyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 22267396) has the molecular formula C23H28ClN5O3S and a molecular weight of 490.03 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N'-(2-hydroxyethyl)-4-phenyl-N-piperidin-1-ylsulfonyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N'-(2-hydroxyethyl)-4-phenyl-N-piperidin-1-ylsulfonyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 22267396 |
| Molecular Formula | C23H28ClN5O3S |
| Molecular Weight | 490.03 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 5-(4-chlorophenyl)-N'-(2-hydroxyethyl)-4-phenyl-N-piperidin-1-ylsulfonyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | O=S(=O)(N/C(=N/CCO)N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1)N1CCCCC1 |
| InChI | InChI=1S/C23H28ClN5O3S/c24-20-11-9-19(10-12-20)22-21(18-7-3-1-4-8-18)17-29(26-22)23(25-13-16-30)27-33(31,32)28-14-5-2-6-15-28/h1,3-4,7-12,21,30H,2,5-6,13-17H2,(H,25,27) |
| InChIKey | FEYQZQYHFDDQAL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.03 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|