C22H22ClF3N4O2S2 — CID 22267364
5-(4-chlorophenyl)-N-piperidin-1-ylsulfonyl-4-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 22267364) has the molecular formula C22H22ClF3N4O2S2 and a molecular weight of 531.03 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-piperidin-1-ylsulfonyl-4-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 5-(4-chlorophenyl)-N-piperidin-1-ylsulfonyl-4-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 22267364 |
| Molecular Formula | C22H22ClF3N4O2S2 |
| Molecular Weight | 531.03 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | 5-(4-chlorophenyl)-N-piperidin-1-ylsulfonyl-4-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | O=S(=O)(NC(=S)N1CC(c2cccc(C(F)(F)F)c2)C(c2ccc(Cl)cc2)=N1)N1CCCCC1 |
| InChI | InChI=1S/C22H22ClF3N4O2S2/c23-18-9-7-15(8-10-18)20-19(16-5-4-6-17(13-16)22(24,25)26)14-30(27-20)21(33)28-34(31,32)29-11-2-1-3-12-29/h4-10,13,19H,1-3,11-12,14H2,(H,28,33) |
| InChIKey | YJUJBGRGOJIRBC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.03 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|