C22H17BrClN3O2S2 — CID 166135596
N-(4-bromophenyl)sulfonyl-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 166135596) has the molecular formula C22H17BrClN3O2S2 and a molecular weight of 534.89 g/mol. Its IUPAC name is N-(4-bromophenyl)sulfonyl-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | N-(4-bromophenyl)sulfonyl-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 166135596 |
| Molecular Formula | C22H17BrClN3O2S2 |
| Molecular Weight | 534.89 g/mol |
| Exact Mass | 532.96 |
| IUPAC Name | N-(4-bromophenyl)sulfonyl-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | O=S(=O)(NC(=S)N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H17BrClN3O2S2/c23-17-8-12-19(13-9-17)31(28,29)26-22(30)27-14-20(15-4-2-1-3-5-15)21(25-27)16-6-10-18(24)11-7-16/h1-13,20H,14H2,(H,26,30) |
| InChIKey | VBGOWVHAMJOKNM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.89 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|