C19H17ClN6O2S2 — CID 170164265
5-(4-chlorophenyl)-N-(2-methyltriazol-4-yl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 170164265) has the molecular formula C19H17ClN6O2S2 and a molecular weight of 460.97 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(2-methyltriazol-4-yl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 5-(4-chlorophenyl)-N-(2-methyltriazol-4-yl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 170164265 |
| Molecular Formula | C19H17ClN6O2S2 |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(2-methyltriazol-4-yl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | Cn1ncc(S(=O)(=O)NC(=S)N2CC(c3ccccc3)C(c3ccc(Cl)cc3)=N2)n1 |
| InChI | InChI=1S/C19H17ClN6O2S2/c1-25-21-11-17(22-25)30(27,28)24-19(29)26-12-16(13-5-3-2-4-6-13)18(23-26)14-7-9-15(20)10-8-14/h2-11,16H,12H2,1H3,(H,24,29) |
| InChIKey | BOAMJTBJDFLLFO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 92.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|