C24H31ClN6O2S — CID 22267368
5-(4-chlorophenyl)-N-(dimethylsulfamoyl)-N'-(1-methylpiperidin-4-yl)-4-phenyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 22267368) has the molecular formula C24H31ClN6O2S and a molecular weight of 503.07 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(dimethylsulfamoyl)-N'-(1-methylpiperidin-4-yl)-4-phenyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N-(dimethylsulfamoyl)-N'-(1-methylpiperidin-4-yl)-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 22267368 |
| Molecular Formula | C24H31ClN6O2S |
| Molecular Weight | 503.07 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(dimethylsulfamoyl)-N'-(1-methylpiperidin-4-yl)-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CN1CCC(/N=C(\NS(=O)(=O)N(C)C)N2CC(c3ccccc3)C(c3ccc(Cl)cc3)=N2)CC1 |
| InChI | InChI=1S/C24H31ClN6O2S/c1-29(2)34(32,33)28-24(26-21-13-15-30(3)16-14-21)31-17-22(18-7-5-4-6-8-18)23(27-31)19-9-11-20(25)12-10-19/h4-12,21-22H,13-17H2,1-3H3,(H,26,28) |
| InChIKey | LIUQEWVGSQLYDJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 80.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.07 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|