C23H25ClF3N5O2S — CID 44608360
5-(4-chlorophenyl)-N'-methyl-4-phenyl-N-[4-(trifluoromethyl)piperidin-1-yl]sulfonyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 44608360) has the molecular formula C23H25ClF3N5O2S and a molecular weight of 528.00 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N'-methyl-4-phenyl-N-[4-(trifluoromethyl)piperidin-1-yl]sulfonyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N'-methyl-4-phenyl-N-[4-(trifluoromethyl)piperidin-1-yl]sulfonyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 44608360 |
| Molecular Formula | C23H25ClF3N5O2S |
| Molecular Weight | 528.00 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | 5-(4-chlorophenyl)-N'-methyl-4-phenyl-N-[4-(trifluoromethyl)piperidin-1-yl]sulfonyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | C/N=C(/NS(=O)(=O)N1CCC(C(F)(F)F)CC1)N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C23H25ClF3N5O2S/c1-28-22(30-35(33,34)31-13-11-18(12-14-31)23(25,26)27)32-15-20(16-5-3-2-4-6-16)21(29-32)17-7-9-19(24)10-8-17/h2-10,18,20H,11-15H2,1H3,(H,28,30) |
| InChIKey | ABYRMVVDOJFFOY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 77.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.00 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|