C22H24ClF2N5O2S — CID 44608681
(4S)-5-(4-chlorophenyl)-N-(4,4-difluoropiperidin-1-yl)sulfonyl-N'-methyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 44608681) has the molecular formula C22H24ClF2N5O2S and a molecular weight of 495.98 g/mol. Its IUPAC name is (4S)-5-(4-chlorophenyl)-N-(4,4-difluoropiperidin-1-yl)sulfonyl-N'-methyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | (4S)-5-(4-chlorophenyl)-N-(4,4-difluoropiperidin-1-yl)sulfonyl-N'-methyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 44608681 |
| Molecular Formula | C22H24ClF2N5O2S |
| Molecular Weight | 495.98 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | (4S)-5-(4-chlorophenyl)-N-(4,4-difluoropiperidin-1-yl)sulfonyl-N'-methyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | C/N=C(/NS(=O)(=O)N1CCC(F)(F)CC1)N1C[C@H](c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C22H24ClF2N5O2S/c1-26-21(28-33(31,32)29-13-11-22(24,25)12-14-29)30-15-19(16-5-3-2-4-6-16)20(27-30)17-7-9-18(23)10-8-17/h2-10,19H,11-15H2,1H3,(H,26,28)/t19-/m1/s1 |
| InChIKey | LXMWJJLAVBIJKA-LJQANCHMSA-N |
| XLogP | 3.69 |
| TPSA | 77.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.98 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|