C24H19ClF3N3O2S2 — CID 169235169
methyl 5-(4-chlorophenyl)-4-phenyl-N-[3-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidothioate (PubChem CID 169235169) has the molecular formula C24H19ClF3N3O2S2 and a molecular weight of 538.02 g/mol. Its IUPAC name is methyl 5-(4-chlorophenyl)-4-phenyl-N-[3-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidothioate.
| Compound Name | methyl 5-(4-chlorophenyl)-4-phenyl-N-[3-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidothioate |
|---|---|
| PubChem CID | 169235169 |
| Molecular Formula | C24H19ClF3N3O2S2 |
| Molecular Weight | 538.02 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | methyl 5-(4-chlorophenyl)-4-phenyl-N-[3-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidothioate |
| SMILES | CSC(=NS(=O)(=O)c1cccc(C(F)(F)F)c1)N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C24H19ClF3N3O2S2/c1-34-23(30-35(32,33)20-9-5-8-18(14-20)24(26,27)28)31-15-21(16-6-3-2-4-7-16)22(29-31)17-10-12-19(25)13-11-17/h2-14,21H,15H2,1H3 |
| InChIKey | FKRXQRVEVYDLGE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.02 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|