C31H27Cl2N3O2S — CID 66791389
4-chloro-N-[[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-(2,4,6-trimethylphenyl)methylidene]benzenesulfonamide (PubChem CID 66791389) has the molecular formula C31H27Cl2N3O2S and a molecular weight of 576.55 g/mol. Its IUPAC name is 4-chloro-N-[[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-(2,4,6-trimethylphenyl)methylidene]benzenesulfonamide.
| Compound Name | 4-chloro-N-[[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-(2,4,6-trimethylphenyl)methylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 66791389 |
| Molecular Formula | C31H27Cl2N3O2S |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 575.12 |
| IUPAC Name | 4-chloro-N-[[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-(2,4,6-trimethylphenyl)methylidene]benzenesulfonamide |
| SMILES | Cc1cc(C)c(C(=NS(=O)(=O)c2ccc(Cl)cc2)N2CC(c3ccccc3)C(c3ccc(Cl)cc3)=N2)c(C)c1 |
| InChI | InChI=1S/C31H27Cl2N3O2S/c1-20-17-21(2)29(22(3)18-20)31(35-39(37,38)27-15-13-26(33)14-16-27)36-19-28(23-7-5-4-6-8-23)30(34-36)24-9-11-25(32)12-10-24/h4-18,28H,19H2,1-3H3 |
| InChIKey | NJVLJDCHONRMMZ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|