C23H19Cl2N3O2S — CID 165011025
5-(4-chlorophenyl)-N-(4-methylphenyl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carboximidoyl chloride (PubChem CID 165011025) has the molecular formula C23H19Cl2N3O2S and a molecular weight of 472.40 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(4-methylphenyl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carboximidoyl chloride.
| Compound Name | 5-(4-chlorophenyl)-N-(4-methylphenyl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carboximidoyl chloride |
|---|---|
| PubChem CID | 165011025 |
| Molecular Formula | C23H19Cl2N3O2S |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(4-methylphenyl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carboximidoyl chloride |
| SMILES | Cc1ccc(S(=O)(=O)N=C(Cl)N2CC(c3ccccc3)C(c3ccc(Cl)cc3)=N2)cc1 |
| InChI | InChI=1S/C23H19Cl2N3O2S/c1-16-7-13-20(14-8-16)31(29,30)27-23(25)28-15-21(17-5-3-2-4-6-17)22(26-28)18-9-11-19(24)12-10-18/h2-14,21H,15H2,1H3 |
| InChIKey | JRXXXMYETWRWOC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|