C22H16ClF2N3O2S — CID 176847757
(2Z)-5-(4-fluorophenyl)-N-(4-fluorophenyl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carboximidoyl chloride (PubChem CID 176847757) has the molecular formula C22H16ClF2N3O2S and a molecular weight of 459.91 g/mol. Its IUPAC name is (2Z)-5-(4-fluorophenyl)-N-(4-fluorophenyl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carboximidoyl chloride.
| Compound Name | (2Z)-5-(4-fluorophenyl)-N-(4-fluorophenyl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carboximidoyl chloride |
|---|---|
| PubChem CID | 176847757 |
| Molecular Formula | C22H16ClF2N3O2S |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | (2Z)-5-(4-fluorophenyl)-N-(4-fluorophenyl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carboximidoyl chloride |
| SMILES | O=S(=O)(/N=C(\Cl)N1CC(c2ccccc2)C(c2ccc(F)cc2)=N1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H16ClF2N3O2S/c23-22(27-31(29,30)19-12-10-18(25)11-13-19)28-14-20(15-4-2-1-3-5-15)21(26-28)16-6-8-17(24)9-7-16/h1-13,20H,14H2/b27-22+ |
| InChIKey | AJRLJFVPIPIKHO-HPNDGRJYSA-N |
| XLogP | 4.75 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|