C25H25ClFN5O4S2 — CID 169235661
(4S)-N'-(4-chlorophenyl)sulfonyl-5-(4-fluorophenyl)-N-methyl-4-phenyl-N-(2-sulfamoylethyl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 169235661) has the molecular formula C25H25ClFN5O4S2 and a molecular weight of 578.09 g/mol. Its IUPAC name is (4S)-N'-(4-chlorophenyl)sulfonyl-5-(4-fluorophenyl)-N-methyl-4-phenyl-N-(2-sulfamoylethyl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | (4S)-N'-(4-chlorophenyl)sulfonyl-5-(4-fluorophenyl)-N-methyl-4-phenyl-N-(2-sulfamoylethyl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 169235661 |
| Molecular Formula | C25H25ClFN5O4S2 |
| Molecular Weight | 578.09 g/mol |
| Exact Mass | 577.10 |
| IUPAC Name | (4S)-N'-(4-chlorophenyl)sulfonyl-5-(4-fluorophenyl)-N-methyl-4-phenyl-N-(2-sulfamoylethyl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CN(CCS(N)(=O)=O)/C(=N/S(=O)(=O)c1ccc(Cl)cc1)N1C[C@H](c2ccccc2)C(c2ccc(F)cc2)=N1 |
| InChI | InChI=1S/C25H25ClFN5O4S2/c1-31(15-16-37(28,33)34)25(30-38(35,36)22-13-9-20(26)10-14-22)32-17-23(18-5-3-2-4-6-18)24(29-32)19-7-11-21(27)12-8-19/h2-14,23H,15-17H2,1H3,(H2,28,33,34)/b30-25-/t23-/m1/s1 |
| InChIKey | JTRBTOFFDWJWRI-GJJRTCBASA-N |
| XLogP | 3.25 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.09 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|