C24H22ClFN4O2S — CID 11213881
5-(4-chlorophenyl)-N'-(4-fluorophenyl)sulfonyl-N,N-dimethyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 11213881) has the molecular formula C24H22ClFN4O2S and a molecular weight of 484.98 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N'-(4-fluorophenyl)sulfonyl-N,N-dimethyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N'-(4-fluorophenyl)sulfonyl-N,N-dimethyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 11213881 |
| Molecular Formula | C24H22ClFN4O2S |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 5-(4-chlorophenyl)-N'-(4-fluorophenyl)sulfonyl-N,N-dimethyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CN(C)/C(=N/S(=O)(=O)c1ccc(F)cc1)N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C24H22ClFN4O2S/c1-29(2)24(28-33(31,32)21-14-12-20(26)13-15-21)30-16-22(17-6-4-3-5-7-17)23(27-30)18-8-10-19(25)11-9-18/h3-15,22H,16H2,1-2H3/b28-24- |
| InChIKey | HCJDEWFWSLGINJ-COOPMVRXSA-N |
| XLogP | 4.59 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|