C31H27Cl2N5O2S — CID 155921874
(2E)-2-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-2-(4-chlorophenyl)sulfonylimino-N'-(2-phenylethyl)ethanimidamide (PubChem CID 155921874) has the molecular formula C31H27Cl2N5O2S and a molecular weight of 604.56 g/mol. Its IUPAC name is (2E)-2-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-2-(4-chlorophenyl)sulfonylimino-N'-(2-phenylethyl)ethanimidamide.
| Compound Name | (2E)-2-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-2-(4-chlorophenyl)sulfonylimino-N'-(2-phenylethyl)ethanimidamide |
|---|---|
| PubChem CID | 155921874 |
| Molecular Formula | C31H27Cl2N5O2S |
| Molecular Weight | 604.56 g/mol |
| Exact Mass | 603.13 |
| IUPAC Name | (2E)-2-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-2-(4-chlorophenyl)sulfonylimino-N'-(2-phenylethyl)ethanimidamide |
| SMILES | NC(=N\CCc1ccccc1)/C(=N\S(=O)(=O)c1ccc(Cl)cc1)N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C31H27Cl2N5O2S/c32-25-13-11-24(12-14-25)29-28(23-9-5-2-6-10-23)21-38(36-29)31(30(34)35-20-19-22-7-3-1-4-8-22)37-41(39,40)27-17-15-26(33)16-18-27/h1-18,28H,19-21H2,(H2,34,35)/b37-31+ |
| InChIKey | XBBOWGGKXPAYFY-USLOJTSYSA-N |
| XLogP | 6.18 |
| TPSA | 100.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|