C27H25Cl2N5O3S — CID 155921875
(NE)-4-chloro-N-[1-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-2-imino-2-morpholin-4-ylethylidene]benzenesulfonamide (PubChem CID 155921875) has the molecular formula C27H25Cl2N5O3S and a molecular weight of 570.50 g/mol. Its IUPAC name is (NE)-4-chloro-N-[1-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-2-imino-2-morpholin-4-ylethylidene]benzenesulfonamide.
| Compound Name | (NE)-4-chloro-N-[1-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-2-imino-2-morpholin-4-ylethylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 155921875 |
| Molecular Formula | C27H25Cl2N5O3S |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 569.11 |
| IUPAC Name | (NE)-4-chloro-N-[1-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-2-imino-2-morpholin-4-ylethylidene]benzenesulfonamide |
| SMILES | [H]/N=C(C(=N\S(=O)(=O)c1ccc(Cl)cc1)/N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1)\N1CCOCC1 |
| InChI | InChI=1S/C27H25Cl2N5O3S/c28-21-8-6-20(7-9-21)25-24(19-4-2-1-3-5-19)18-34(31-25)27(26(30)33-14-16-37-17-15-33)32-38(35,36)23-12-10-22(29)11-13-23/h1-13,24,30H,14-18H2/b30-26-,32-27+ |
| InChIKey | MRXDUKZBXNBBRN-YNGONTGSSA-N |
| XLogP | 4.89 |
| TPSA | 98.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|