C26H25Cl2N5O4S2 — CID 175955127
(3R)-1-[C-[(4R)-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-(4-chlorophenyl)sulfonylcarbonimidoyl]pyrrolidine-3-sulfonamide (PubChem CID 175955127) has the molecular formula C26H25Cl2N5O4S2 and a molecular weight of 606.56 g/mol. Its IUPAC name is (3R)-1-[C-[(4R)-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-(4-chlorophenyl)sulfonylcarbonimidoyl]pyrrolidine-3-sulfonamide.
| Compound Name | (3R)-1-[C-[(4R)-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-(4-chlorophenyl)sulfonylcarbonimidoyl]pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 175955127 |
| Molecular Formula | C26H25Cl2N5O4S2 |
| Molecular Weight | 606.56 g/mol |
| Exact Mass | 605.07 |
| IUPAC Name | (3R)-1-[C-[(4R)-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]-N-(4-chlorophenyl)sulfonylcarbonimidoyl]pyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)[C@@H]1CCN(C(=NS(=O)(=O)c2ccc(Cl)cc2)N2C[C@@H](c3ccccc3)C(c3ccc(Cl)cc3)=N2)C1 |
| InChI | InChI=1S/C26H25Cl2N5O4S2/c27-20-8-6-19(7-9-20)25-24(18-4-2-1-3-5-18)17-33(30-25)26(32-15-14-23(16-32)38(29,34)35)31-39(36,37)22-12-10-21(28)11-13-22/h1-13,23-24H,14-17H2,(H2,29,34,35)/t23-,24+/m1/s1 |
| InChIKey | BIEYZSNLRPJCTA-RPWUZVMVSA-N |
| XLogP | 3.90 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|