C25H20ClF3N4O3S2 — CID 175679553
(2-amino-2-oxoethyl) (2Z)-5-(4-chlorophenyl)-4-phenyl-N-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidothioate (PubChem CID 175679553) has the molecular formula C25H20ClF3N4O3S2 and a molecular weight of 581.04 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (2Z)-5-(4-chlorophenyl)-4-phenyl-N-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidothioate.
| Compound Name | (2-amino-2-oxoethyl) (2Z)-5-(4-chlorophenyl)-4-phenyl-N-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidothioate |
|---|---|
| PubChem CID | 175679553 |
| Molecular Formula | C25H20ClF3N4O3S2 |
| Molecular Weight | 581.04 g/mol |
| Exact Mass | 580.06 |
| IUPAC Name | (2-amino-2-oxoethyl) (2Z)-5-(4-chlorophenyl)-4-phenyl-N-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidothioate |
| SMILES | NC(=O)CS/C(=N\S(=O)(=O)c1ccc(C(F)(F)F)cc1)N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C25H20ClF3N4O3S2/c26-19-10-6-17(7-11-19)23-21(16-4-2-1-3-5-16)14-33(31-23)24(37-15-22(30)34)32-38(35,36)20-12-8-18(9-13-20)25(27,28)29/h1-13,21H,14-15H2,(H2,30,34)/b32-24- |
| InChIKey | SUKWPKAODPKDJN-TZHWMEPESA-N |
| XLogP | 5.13 |
| TPSA | 105.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.04 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|