C26H22ClN5O3S2 — CID 176792165
(2-amino-2-oxoethyl) (2Z)-6-(4-chlorophenyl)-N-(4-isocyanophenyl)sulfonyl-5-phenyl-4,5-dihydro-3H-pyridazine-2-carboximidothioate (PubChem CID 176792165) has the molecular formula C26H22ClN5O3S2 and a molecular weight of 552.08 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (2Z)-6-(4-chlorophenyl)-N-(4-isocyanophenyl)sulfonyl-5-phenyl-4,5-dihydro-3H-pyridazine-2-carboximidothioate.
| Compound Name | (2-amino-2-oxoethyl) (2Z)-6-(4-chlorophenyl)-N-(4-isocyanophenyl)sulfonyl-5-phenyl-4,5-dihydro-3H-pyridazine-2-carboximidothioate |
|---|---|
| PubChem CID | 176792165 |
| Molecular Formula | C26H22ClN5O3S2 |
| Molecular Weight | 552.08 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | (2-amino-2-oxoethyl) (2Z)-6-(4-chlorophenyl)-N-(4-isocyanophenyl)sulfonyl-5-phenyl-4,5-dihydro-3H-pyridazine-2-carboximidothioate |
| SMILES | [C-]#[N+]c1ccc(S(=O)(=O)/N=C(\SCC(N)=O)N2CCC(c3ccccc3)C(c3ccc(Cl)cc3)=N2)cc1 |
| InChI | InChI=1S/C26H22ClN5O3S2/c1-29-21-11-13-22(14-12-21)37(34,35)31-26(36-17-24(28)33)32-16-15-23(18-5-3-2-4-6-18)25(30-32)19-7-9-20(27)10-8-19/h2-14,23H,15-17H2,(H2,28,33)/b31-26- |
| InChIKey | GDRZQQWHXLJJMZ-ZXPTYKNPSA-N |
| XLogP | 5.05 |
| TPSA | 109.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.08 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|