C25H24ClN5O2S2 — CID 174115440
methyl N'-[N-(benzenesulfonyl)-C-[6-(4-chlorophenyl)-5-phenyl-4,5-dihydro-3H-pyridazin-2-yl]carbonimidoyl]carbamimidothioate (PubChem CID 174115440) has the molecular formula C25H24ClN5O2S2 and a molecular weight of 526.09 g/mol. Its IUPAC name is methyl N'-[N-(benzenesulfonyl)-C-[6-(4-chlorophenyl)-5-phenyl-4,5-dihydro-3H-pyridazin-2-yl]carbonimidoyl]carbamimidothioate.
| Compound Name | methyl N'-[N-(benzenesulfonyl)-C-[6-(4-chlorophenyl)-5-phenyl-4,5-dihydro-3H-pyridazin-2-yl]carbonimidoyl]carbamimidothioate |
|---|---|
| PubChem CID | 174115440 |
| Molecular Formula | C25H24ClN5O2S2 |
| Molecular Weight | 526.09 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | methyl N'-[N-(benzenesulfonyl)-C-[6-(4-chlorophenyl)-5-phenyl-4,5-dihydro-3H-pyridazin-2-yl]carbonimidoyl]carbamimidothioate |
| SMILES | CSC(N)=NC(=NS(=O)(=O)c1ccccc1)N1CCC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C25H24ClN5O2S2/c1-34-24(27)28-25(30-35(32,33)21-10-6-3-7-11-21)31-17-16-22(18-8-4-2-5-9-18)23(29-31)19-12-14-20(26)15-13-19/h2-15,22H,16-17H2,1H3,(H2,27,28,30) |
| InChIKey | NRZXZYHABFGMMZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 100.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.09 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|