C26H23ClF3N5S2 — CID 169188935
methyl N'-[(Z)-C-[6-(4-chlorophenyl)-5-phenyl-4,5-dihydro-3H-pyridazin-2-yl]-N-[3-(trifluoromethyl)phenyl]sulfanylcarbonimidoyl]carbamimidothioate (PubChem CID 169188935) has the molecular formula C26H23ClF3N5S2 and a molecular weight of 562.09 g/mol. Its IUPAC name is methyl N'-[(Z)-C-[6-(4-chlorophenyl)-5-phenyl-4,5-dihydro-3H-pyridazin-2-yl]-N-[3-(trifluoromethyl)phenyl]sulfanylcarbonimidoyl]carbamimidothioate.
| Compound Name | methyl N'-[(Z)-C-[6-(4-chlorophenyl)-5-phenyl-4,5-dihydro-3H-pyridazin-2-yl]-N-[3-(trifluoromethyl)phenyl]sulfanylcarbonimidoyl]carbamimidothioate |
|---|---|
| PubChem CID | 169188935 |
| Molecular Formula | C26H23ClF3N5S2 |
| Molecular Weight | 562.09 g/mol |
| Exact Mass | 561.10 |
| IUPAC Name | methyl N'-[(Z)-C-[6-(4-chlorophenyl)-5-phenyl-4,5-dihydro-3H-pyridazin-2-yl]-N-[3-(trifluoromethyl)phenyl]sulfanylcarbonimidoyl]carbamimidothioate |
| SMILES | CS/C(N)=N\C(=N\Sc1cccc(C(F)(F)F)c1)N1CCC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C26H23ClF3N5S2/c1-36-24(31)32-25(34-37-21-9-5-8-19(16-21)26(28,29)30)35-15-14-22(17-6-3-2-4-7-17)23(33-35)18-10-12-20(27)13-11-18/h2-13,16,22H,14-15H2,1H3,(H2,31,32,34) |
| InChIKey | DOEAWCPMJOTBFW-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 66.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.09 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|