C27H26ClN3S2 — CID 169235278
ethane;methyl 5-(4-chlorophenyl)-N-(3-ethynylphenyl)sulfanyl-4-phenyl-3,4-dihydropyrazole-2-carboximidothioate (PubChem CID 169235278) has the molecular formula C27H26ClN3S2 and a molecular weight of 492.11 g/mol. Its IUPAC name is ethane;methyl 5-(4-chlorophenyl)-N-(3-ethynylphenyl)sulfanyl-4-phenyl-3,4-dihydropyrazole-2-carboximidothioate.
| Compound Name | ethane;methyl 5-(4-chlorophenyl)-N-(3-ethynylphenyl)sulfanyl-4-phenyl-3,4-dihydropyrazole-2-carboximidothioate |
|---|---|
| PubChem CID | 169235278 |
| Molecular Formula | C27H26ClN3S2 |
| Molecular Weight | 492.11 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | ethane;methyl 5-(4-chlorophenyl)-N-(3-ethynylphenyl)sulfanyl-4-phenyl-3,4-dihydropyrazole-2-carboximidothioate |
| SMILES | C#Cc1cccc(SN=C(SC)N2CC(c3ccccc3)C(c3ccc(Cl)cc3)=N2)c1.CC |
| InChI | InChI=1S/C25H20ClN3S2.C2H6/c1-3-18-8-7-11-22(16-18)31-28-25(30-2)29-17-23(19-9-5-4-6-10-19)24(27-29)20-12-14-21(26)15-13-20;1-2/h1,4-16,23H,17H2,2H3;1-2H3 |
| InChIKey | FWTVKDFCCWRAGB-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.11 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|