C28H32Cl2N6S2 — CID 169235205
N'-[3-(aminosulfanylamino)cyclobutyl]-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfanyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide;ethane (PubChem CID 169235205) has the molecular formula C28H32Cl2N6S2 and a molecular weight of 587.65 g/mol. Its IUPAC name is N'-[3-(aminosulfanylamino)cyclobutyl]-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfanyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide;ethane.
| Compound Name | N'-[3-(aminosulfanylamino)cyclobutyl]-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfanyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide;ethane |
|---|---|
| PubChem CID | 169235205 |
| Molecular Formula | C28H32Cl2N6S2 |
| Molecular Weight | 587.65 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | N'-[3-(aminosulfanylamino)cyclobutyl]-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfanyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide;ethane |
| SMILES | CC.NSNC1CC(/N=C(\NSc2ccc(Cl)cc2)N2CC(c3ccccc3)C(c3ccc(Cl)cc3)=N2)C1 |
| InChI | InChI=1S/C26H26Cl2N6S2.C2H6/c27-19-8-6-18(7-9-19)25-24(17-4-2-1-3-5-17)16-34(31-25)26(30-21-14-22(15-21)32-36-29)33-35-23-12-10-20(28)11-13-23;1-2/h1-13,21-22,24,32H,14-16,29H2,(H,30,33);1-2H3 |
| InChIKey | HIXKEFKKSNLHDR-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 78.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.65 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|