C23H19Cl2N3S2 — CID 169188877
6-(4-chlorophenyl)-N-(4-chlorophenyl)sulfanyl-5-phenyl-4,5-dihydro-3H-pyridazine-2-carbothioamide (PubChem CID 169188877) has the molecular formula C23H19Cl2N3S2 and a molecular weight of 472.47 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-(4-chlorophenyl)sulfanyl-5-phenyl-4,5-dihydro-3H-pyridazine-2-carbothioamide.
| Compound Name | 6-(4-chlorophenyl)-N-(4-chlorophenyl)sulfanyl-5-phenyl-4,5-dihydro-3H-pyridazine-2-carbothioamide |
|---|---|
| PubChem CID | 169188877 |
| Molecular Formula | C23H19Cl2N3S2 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | 6-(4-chlorophenyl)-N-(4-chlorophenyl)sulfanyl-5-phenyl-4,5-dihydro-3H-pyridazine-2-carbothioamide |
| SMILES | S=C(NSc1ccc(Cl)cc1)N1CCC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C23H19Cl2N3S2/c24-18-8-6-17(7-9-18)22-21(16-4-2-1-3-5-16)14-15-28(26-22)23(29)27-30-20-12-10-19(25)11-13-20/h1-13,21H,14-15H2,(H,27,29) |
| InChIKey | WHAFEFAOEWCRFI-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|