C24H22ClN3OS — CID 169188870
6-(4-chlorophenyl)-N-(4-methylphenyl)sulfanyl-5-phenyl-4,5-dihydro-3H-pyridazine-2-carboxamide (PubChem CID 169188870) has the molecular formula C24H22ClN3OS and a molecular weight of 435.98 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-(4-methylphenyl)sulfanyl-5-phenyl-4,5-dihydro-3H-pyridazine-2-carboxamide.
| Compound Name | 6-(4-chlorophenyl)-N-(4-methylphenyl)sulfanyl-5-phenyl-4,5-dihydro-3H-pyridazine-2-carboxamide |
|---|---|
| PubChem CID | 169188870 |
| Molecular Formula | C24H22ClN3OS |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 6-(4-chlorophenyl)-N-(4-methylphenyl)sulfanyl-5-phenyl-4,5-dihydro-3H-pyridazine-2-carboxamide |
| SMILES | Cc1ccc(SNC(=O)N2CCC(c3ccccc3)C(c3ccc(Cl)cc3)=N2)cc1 |
| InChI | InChI=1S/C24H22ClN3OS/c1-17-7-13-21(14-8-17)30-27-24(29)28-16-15-22(18-5-3-2-4-6-18)23(26-28)19-9-11-20(25)12-10-19/h2-14,22H,15-16H2,1H3,(H,27,29) |
| InChIKey | CBRHTRKMONFHRC-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|