C24H19ClF3N3OS — CID 169188832
6-(4-chlorophenyl)-5-phenyl-N-[4-(trifluoromethyl)phenyl]sulfanyl-4,5-dihydro-3H-pyridazine-2-carboxamide (PubChem CID 169188832) has the molecular formula C24H19ClF3N3OS and a molecular weight of 489.95 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-5-phenyl-N-[4-(trifluoromethyl)phenyl]sulfanyl-4,5-dihydro-3H-pyridazine-2-carboxamide.
| Compound Name | 6-(4-chlorophenyl)-5-phenyl-N-[4-(trifluoromethyl)phenyl]sulfanyl-4,5-dihydro-3H-pyridazine-2-carboxamide |
|---|---|
| PubChem CID | 169188832 |
| Molecular Formula | C24H19ClF3N3OS |
| Molecular Weight | 489.95 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 6-(4-chlorophenyl)-5-phenyl-N-[4-(trifluoromethyl)phenyl]sulfanyl-4,5-dihydro-3H-pyridazine-2-carboxamide |
| SMILES | O=C(NSc1ccc(C(F)(F)F)cc1)N1CCC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C24H19ClF3N3OS/c25-19-10-6-17(7-11-19)22-21(16-4-2-1-3-5-16)14-15-31(29-22)23(32)30-33-20-12-8-18(9-13-20)24(26,27)28/h1-13,21H,14-15H2,(H,30,32) |
| InChIKey | VXZIFZVRXSNUGB-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.95 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|