C23H17ClF3N3O2S2 — CID 166135583
5-(4-chlorophenyl)-4-phenyl-N-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 166135583) has the molecular formula C23H17ClF3N3O2S2 and a molecular weight of 523.99 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-phenyl-N-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 5-(4-chlorophenyl)-4-phenyl-N-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 166135583 |
| Molecular Formula | C23H17ClF3N3O2S2 |
| Molecular Weight | 523.99 g/mol |
| Exact Mass | 523.04 |
| IUPAC Name | 5-(4-chlorophenyl)-4-phenyl-N-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | O=S(=O)(NC(=S)N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H17ClF3N3O2S2/c24-18-10-6-16(7-11-18)21-20(15-4-2-1-3-5-15)14-30(28-21)22(33)29-34(31,32)19-12-8-17(9-13-19)23(25,26)27/h1-13,20H,14H2,(H,29,33) |
| InChIKey | DUGCLCQRMDNKKK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.99 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|