C23H18ClF3N4O2S — CID 163507050
(4S)-5-(4-chlorophenyl)-4-phenyl-N'-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 163507050) has the molecular formula C23H18ClF3N4O2S and a molecular weight of 506.94 g/mol. Its IUPAC name is (4S)-5-(4-chlorophenyl)-4-phenyl-N'-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | (4S)-5-(4-chlorophenyl)-4-phenyl-N'-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 163507050 |
| Molecular Formula | C23H18ClF3N4O2S |
| Molecular Weight | 506.94 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | (4S)-5-(4-chlorophenyl)-4-phenyl-N'-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | NC(=NS(=O)(=O)c1ccc(C(F)(F)F)cc1)N1C[C@H](c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C23H18ClF3N4O2S/c24-18-10-6-16(7-11-18)21-20(15-4-2-1-3-5-15)14-31(29-21)22(28)30-34(32,33)19-12-8-17(9-13-19)23(25,26)27/h1-13,20H,14H2,(H2,28,30)/t20-/m1/s1 |
| InChIKey | CZKWZCULSCGYSV-HXUWFJFHSA-N |
| XLogP | 4.87 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.94 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|