C26H27Cl2N5S2 — CID 169235559
N'-(4-aminosulfanylbutyl)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfanyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 169235559) has the molecular formula C26H27Cl2N5S2 and a molecular weight of 544.58 g/mol. Its IUPAC name is N'-(4-aminosulfanylbutyl)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfanyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N'-(4-aminosulfanylbutyl)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfanyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 169235559 |
| Molecular Formula | C26H27Cl2N5S2 |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | N'-(4-aminosulfanylbutyl)-5-(4-chlorophenyl)-N-(4-chlorophenyl)sulfanyl-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | NSCCCC/N=C(\NSc1ccc(Cl)cc1)N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C26H27Cl2N5S2/c27-21-10-8-20(9-11-21)25-24(19-6-2-1-3-7-19)18-33(31-25)26(30-16-4-5-17-34-29)32-35-23-14-12-22(28)13-15-23/h1-3,6-15,24H,4-5,16-18,29H2,(H,30,32) |
| InChIKey | UOJMGNBAZLOQPN-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|