C26H20ClF3N4O3 — CID 24866397
2-[[[(4-chlorobenzoyl)amino]-[4-phenyl-5-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-2-yl]methylidene]amino]acetic acid (PubChem CID 24866397) has the molecular formula C26H20ClF3N4O3 and a molecular weight of 528.92 g/mol. Its IUPAC name is 2-[[[(4-chlorobenzoyl)amino]-[4-phenyl-5-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-2-yl]methylidene]amino]acetic acid.
| Compound Name | 2-[[[(4-chlorobenzoyl)amino]-[4-phenyl-5-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-2-yl]methylidene]amino]acetic acid |
|---|---|
| PubChem CID | 24866397 |
| Molecular Formula | C26H20ClF3N4O3 |
| Molecular Weight | 528.92 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 2-[[[(4-chlorobenzoyl)amino]-[4-phenyl-5-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-2-yl]methylidene]amino]acetic acid |
| SMILES | O=C(O)C/N=C(\NC(=O)c1ccc(Cl)cc1)N1CC(c2ccccc2)C(c2ccc(C(F)(F)F)cc2)=N1 |
| InChI | InChI=1S/C26H20ClF3N4O3/c27-20-12-8-18(9-13-20)24(37)32-25(31-14-22(35)36)34-15-21(16-4-2-1-3-5-16)23(33-34)17-6-10-19(11-7-17)26(28,29)30/h1-13,21H,14-15H2,(H,35,36)(H,31,32,37) |
| InChIKey | SQLLXVRXGIUIMS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.92 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|