C21H25ClN8S2 — CID 169235079
[[N-(2-aminosulfanylethyl)-C-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]carbonimidoyl]amino] (2Z)-2-(methylhydrazinylidene)ethanimidothioate (PubChem CID 169235079) has the molecular formula C21H25ClN8S2 and a molecular weight of 489.07 g/mol. Its IUPAC name is [[N-(2-aminosulfanylethyl)-C-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]carbonimidoyl]amino] (2Z)-2-(methylhydrazinylidene)ethanimidothioate.
| Compound Name | [[N-(2-aminosulfanylethyl)-C-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]carbonimidoyl]amino] (2Z)-2-(methylhydrazinylidene)ethanimidothioate |
|---|---|
| PubChem CID | 169235079 |
| Molecular Formula | C21H25ClN8S2 |
| Molecular Weight | 489.07 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | [[N-(2-aminosulfanylethyl)-C-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]carbonimidoyl]amino] (2Z)-2-(methylhydrazinylidene)ethanimidothioate |
| SMILES | [H]/N=C(\C=N/NC)SN/C(=N\CCSN)N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C21H25ClN8S2/c1-25-27-13-19(23)32-29-21(26-11-12-31-24)30-14-18(15-5-3-2-4-6-15)20(28-30)16-7-9-17(22)10-8-16/h2-10,13,18,23,25H,11-12,14,24H2,1H3,(H,26,29)/b23-19+,27-13- |
| InChIKey | NWSLKCJWDYAHQV-HJOAALCOSA-N |
| XLogP | 3.53 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.07 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|