C18H18ClN5 — CID 163902489
(4S)-N-(1-aminoethylidene)-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 163902489) has the molecular formula C18H18ClN5 and a molecular weight of 339.83 g/mol. Its IUPAC name is (4S)-N-(1-aminoethylidene)-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | (4S)-N-(1-aminoethylidene)-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 163902489 |
| Molecular Formula | C18H18ClN5 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (4S)-N-(1-aminoethylidene)-5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | [H]/N=C(\N=C(C)N)N1C[C@H](c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C18H18ClN5/c1-12(20)22-18(21)24-11-16(13-5-3-2-4-6-13)17(23-24)14-7-9-15(19)10-8-14/h2-10,16H,11H2,1H3,(H3,20,21,22)/t16-/m1/s1 |
| InChIKey | QLBNRNCOLIRFSD-MRXNPFEDSA-N |
| XLogP | 3.46 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|