C25H23Cl2N5O2S2 — CID 174115425
methyl N'-[C-[6-(4-chlorophenyl)-5-phenyl-4,5-dihydro-3H-pyridazin-2-yl]-N-(4-chlorophenyl)sulfonylcarbonimidoyl]carbamimidothioate (PubChem CID 174115425) has the molecular formula C25H23Cl2N5O2S2 and a molecular weight of 560.53 g/mol. Its IUPAC name is methyl N'-[C-[6-(4-chlorophenyl)-5-phenyl-4,5-dihydro-3H-pyridazin-2-yl]-N-(4-chlorophenyl)sulfonylcarbonimidoyl]carbamimidothioate.
| Compound Name | methyl N'-[C-[6-(4-chlorophenyl)-5-phenyl-4,5-dihydro-3H-pyridazin-2-yl]-N-(4-chlorophenyl)sulfonylcarbonimidoyl]carbamimidothioate |
|---|---|
| PubChem CID | 174115425 |
| Molecular Formula | C25H23Cl2N5O2S2 |
| Molecular Weight | 560.53 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | methyl N'-[C-[6-(4-chlorophenyl)-5-phenyl-4,5-dihydro-3H-pyridazin-2-yl]-N-(4-chlorophenyl)sulfonylcarbonimidoyl]carbamimidothioate |
| SMILES | CSC(N)=NC(=NS(=O)(=O)c1ccc(Cl)cc1)N1CCC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C25H23Cl2N5O2S2/c1-35-24(28)29-25(31-36(33,34)21-13-11-20(27)12-14-21)32-16-15-22(17-5-3-2-4-6-17)23(30-32)18-7-9-19(26)10-8-18/h2-14,22H,15-16H2,1H3,(H2,28,29,31) |
| InChIKey | VSBPWISKLFLHBG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 100.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|