C29H32FN5O4S2 — CID 169235073
5-(4-fluorophenyl)-N-(4-methylphenyl)sulfonyl-4-phenyl-N'-(4-sulfamoylcyclohexyl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 169235073) has the molecular formula C29H32FN5O4S2 and a molecular weight of 597.74 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(4-methylphenyl)sulfonyl-4-phenyl-N'-(4-sulfamoylcyclohexyl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-fluorophenyl)-N-(4-methylphenyl)sulfonyl-4-phenyl-N'-(4-sulfamoylcyclohexyl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 169235073 |
| Molecular Formula | C29H32FN5O4S2 |
| Molecular Weight | 597.74 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(4-methylphenyl)sulfonyl-4-phenyl-N'-(4-sulfamoylcyclohexyl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | Cc1ccc(S(=O)(=O)N/C(=N\C2CCC(S(N)(=O)=O)CC2)N2CC(c3ccccc3)C(c3ccc(F)cc3)=N2)cc1 |
| InChI | InChI=1S/C29H32FN5O4S2/c1-20-7-15-26(16-8-20)41(38,39)34-29(32-24-13-17-25(18-14-24)40(31,36)37)35-19-27(21-5-3-2-4-6-21)28(33-35)22-9-11-23(30)12-10-22/h2-12,15-16,24-25,27H,13-14,17-19H2,1H3,(H,32,34)(H2,31,36,37) |
| InChIKey | YIUNOFIQCSFGHU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.74 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|