C15H19N5O2S2 — CID 59339452
N-(1,3-benzothiazol-6-ylsulfonyl)-N',4-diethyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 59339452) has the molecular formula C15H19N5O2S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-ylsulfonyl)-N',4-diethyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N-(1,3-benzothiazol-6-ylsulfonyl)-N',4-diethyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 59339452 |
| Molecular Formula | C15H19N5O2S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-(1,3-benzothiazol-6-ylsulfonyl)-N',4-diethyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CC/N=C(/NS(=O)(=O)c1ccc2ncsc2c1)N1CC(CC)C=N1 |
| InChI | InChI=1S/C15H19N5O2S2/c1-3-11-8-18-20(9-11)15(16-4-2)19-24(21,22)12-5-6-13-14(7-12)23-10-17-13/h5-8,10-11H,3-4,9H2,1-2H3,(H,16,19) |
| InChIKey | LMVBVRNSBMINPT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 87.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|