C19H21N5O4S2 — CID 146530078
[5-(1,3-benzothiazol-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-[(5-methyl-1,2-oxazol-3-yl)methylamino]methanol (PubChem CID 146530078) has the molecular formula C19H21N5O4S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is [5-(1,3-benzothiazol-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-[(5-methyl-1,2-oxazol-3-yl)methylamino]methanol.
| Compound Name | [5-(1,3-benzothiazol-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-[(5-methyl-1,2-oxazol-3-yl)methylamino]methanol |
|---|---|
| PubChem CID | 146530078 |
| Molecular Formula | C19H21N5O4S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [5-(1,3-benzothiazol-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-[(5-methyl-1,2-oxazol-3-yl)methylamino]methanol |
| SMILES | Cc1cc(CNC(O)N2CC3=C(C2)CN(S(=O)(=O)c2ccc4ncsc4c2)C3)no1 |
| InChI | InChI=1S/C19H21N5O4S2/c1-12-4-15(22-28-12)6-20-19(25)23-7-13-9-24(10-14(13)8-23)30(26,27)16-2-3-17-18(5-16)29-11-21-17/h2-5,11,19-20,25H,6-10H2,1H3 |
| InChIKey | RFYDNRWQZLKMAU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|