C19H21N3O2S2 — CID 167892269
6-[4-(2-phenylethyl)piperazin-1-yl]sulfonyl-1,3-benzothiazole (PubChem CID 167892269) has the molecular formula C19H21N3O2S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 6-[4-(2-phenylethyl)piperazin-1-yl]sulfonyl-1,3-benzothiazole.
| Compound Name | 6-[4-(2-phenylethyl)piperazin-1-yl]sulfonyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 167892269 |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 6-[4-(2-phenylethyl)piperazin-1-yl]sulfonyl-1,3-benzothiazole |
| SMILES | O=S(=O)(c1ccc2ncsc2c1)N1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H21N3O2S2/c23-26(24,17-6-7-18-19(14-17)25-15-20-18)22-12-10-21(11-13-22)9-8-16-4-2-1-3-5-16/h1-7,14-15H,8-13H2 |
| InChIKey | INDXOZCAWTYZQZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |