C15H21N3O4S3 — CID 146150664
N-(1-propylsulfonylpiperidin-4-yl)-1,3-benzothiazole-5-sulfonamide (PubChem CID 146150664) has the molecular formula C15H21N3O4S3 and a molecular weight of 403.55 g/mol. Its IUPAC name is N-(1-propylsulfonylpiperidin-4-yl)-1,3-benzothiazole-5-sulfonamide.
| Compound Name | N-(1-propylsulfonylpiperidin-4-yl)-1,3-benzothiazole-5-sulfonamide |
|---|---|
| PubChem CID | 146150664 |
| Molecular Formula | C15H21N3O4S3 |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | N-(1-propylsulfonylpiperidin-4-yl)-1,3-benzothiazole-5-sulfonamide |
| SMILES | CCCS(=O)(=O)N1CCC(NS(=O)(=O)c2ccc3scnc3c2)CC1 |
| InChI | InChI=1S/C15H21N3O4S3/c1-2-9-24(19,20)18-7-5-12(6-8-18)17-25(21,22)13-3-4-15-14(10-13)16-11-23-15/h3-4,10-12,17H,2,5-9H2,1H3 |
| InChIKey | VTSCMYRZASAGDO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |