About 4-phenyloxathiolane
4-phenyloxathiolane (PubChem CID 101444581) has the molecular formula C9H10OS
and a molecular weight of 166.25 g/mol. Its IUPAC name is 4-phenyloxathiolane.
Molecular Properties
| Compound Name | 4-phenyloxathiolane |
| PubChem CID | 101444581 |
| Molecular Formula | C9H10OS |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 4-phenyloxathiolane |
| SMILES | c1ccc(C2COSC2)cc1 |
| InChI | InChI=1S/C9H10OS/c1-2-4-8(5-3-1)9-6-10-11-7-9/h1-5,9H,6-7H2 |
| InChIKey | GJNSSOXZKMBGLL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyloxathiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyloxathiolane?
The IUPAC name of 4-phenyloxathiolane (CID 101444581) is 4-phenyloxathiolane.
What is the SMILES notation for 4-phenyloxathiolane?
The canonical SMILES for 4-phenyloxathiolane is c1ccc(C2COSC2)cc1.
What is the InChIKey of 4-phenyloxathiolane?
The InChIKey is GJNSSOXZKMBGLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10OS/c1-2-4-8(5-3-1)9-6-10-11-7-9/h1-5,9H,6-7H2.
What are the key properties of 4-phenyloxathiolane?
4-phenyloxathiolane has a molecular weight of 166.25 g/mol, XLogP of 2.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyloxathiolane is sourced from PubChem (CID 101444581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).