C12H12N2O2 — CID 102076200
(6S)-6-phenyl-3,3a,4,6-tetrahydropyrrolo[3,4-c][1,2]oxazole-5-carbaldehyde (PubChem CID 102076200) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is (6S)-6-phenyl-3,3a,4,6-tetrahydropyrrolo[3,4-c][1,2]oxazole-5-carbaldehyde.
| Compound Name | (6S)-6-phenyl-3,3a,4,6-tetrahydropyrrolo[3,4-c][1,2]oxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 102076200 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | (6S)-6-phenyl-3,3a,4,6-tetrahydropyrrolo[3,4-c][1,2]oxazole-5-carbaldehyde |
| SMILES | O=CN1CC2CON=C2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C12H12N2O2/c15-8-14-6-10-7-16-13-11(10)12(14)9-4-2-1-3-5-9/h1-5,8,10,12H,6-7H2/t10?,12-/m0/s1 |
| InChIKey | FZDTXDJSGQTGLY-KFJBMODSSA-N |
| XLogP | 1.20 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|