C19H20N2O2 — CID 100966274
5-methyl-2,3-diphenylpiperazine-1,4-dicarbaldehyde (PubChem CID 100966274) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 5-methyl-2,3-diphenylpiperazine-1,4-dicarbaldehyde.
| Compound Name | 5-methyl-2,3-diphenylpiperazine-1,4-dicarbaldehyde |
|---|---|
| PubChem CID | 100966274 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 5-methyl-2,3-diphenylpiperazine-1,4-dicarbaldehyde |
| SMILES | CC1CN(C=O)C(c2ccccc2)C(c2ccccc2)N1C=O |
| InChI | InChI=1S/C19H20N2O2/c1-15-12-20(13-22)18(16-8-4-2-5-9-16)19(21(15)14-23)17-10-6-3-7-11-17/h2-11,13-15,18-19H,12H2,1H3 |
| InChIKey | IXEGKASGJZDXLJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|