C18H19NO — CID 101147043
(1R,3S)-1,3-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 101147043) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is (1R,3S)-1,3-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | (1R,3S)-1,3-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 101147043 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (1R,3S)-1,3-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | C[C@@H]1c2ccccc2C(c2ccccc2)[C@H](C)N1C=O |
| InChI | InChI=1S/C18H19NO/c1-13-16-10-6-7-11-17(16)18(14(2)19(13)12-20)15-8-4-3-5-9-15/h3-14,18H,1-2H3/t13-,14+,18?/m1/s1 |
| InChIKey | WEVCICGEJBADDD-RMAOKOMNSA-N |
| XLogP | 3.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|