C17H18NO+ — CID 11809925
(2R,3R,4S,8bS)-2,3-dimethyl-4-phenyl-4,8b-dihydro-3H-oxazireno[3,2-a]isoquinolin-2-ium (PubChem CID 11809925) has the molecular formula C17H18NO+ and a molecular weight of 252.34 g/mol. Its IUPAC name is (2R,3R,4S,8bS)-2,3-dimethyl-4-phenyl-4,8b-dihydro-3H-oxazireno[3,2-a]isoquinolin-2-ium.
| Compound Name | (2R,3R,4S,8bS)-2,3-dimethyl-4-phenyl-4,8b-dihydro-3H-oxazireno[3,2-a]isoquinolin-2-ium |
|---|---|
| PubChem CID | 11809925 |
| Molecular Formula | C17H18NO+ |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (2R,3R,4S,8bS)-2,3-dimethyl-4-phenyl-4,8b-dihydro-3H-oxazireno[3,2-a]isoquinolin-2-ium |
| SMILES | C[C@@H]1[C@@H](c2ccccc2)c2ccccc2[C@@H]2O[N@+]12C |
| InChI | InChI=1S/C17H18NO/c1-12-16(13-8-4-3-5-9-13)14-10-6-7-11-15(14)17-18(12,2)19-17/h3-12,16-17H,1-2H3/q+1/t12-,16+,17+,18-/m1/s1 |
| InChIKey | LXVJPYIVOBSMHG-PBZHRCKQSA-N |
| XLogP | 3.61 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|