C17H20ClNO4 — CID 140650295
1,1,2-trimethyl-3-phenyl-2,3-dihydroindol-1-ium perchlorate (PubChem CID 140650295) has the molecular formula C17H20ClNO4 and a molecular weight of 337.80 g/mol. Its IUPAC name is 1,1,2-trimethyl-3-phenyl-2,3-dihydroindol-1-ium perchlorate.
| Compound Name | 1,1,2-trimethyl-3-phenyl-2,3-dihydroindol-1-ium perchlorate |
|---|---|
| PubChem CID | 140650295 |
| Molecular Formula | C17H20ClNO4 |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 1,1,2-trimethyl-3-phenyl-2,3-dihydroindol-1-ium perchlorate |
| SMILES | CC1C(c2ccccc2)c2ccccc2[N+]1(C)C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C17H20N.ClHO4/c1-13-17(14-9-5-4-6-10-14)15-11-7-8-12-16(15)18(13,2)3;2-1(3,4)5/h4-13,17H,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | KBIVZBRNXOHWRE-UHFFFAOYSA-M |
| XLogP | -0.97 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|