C24H18N2 — CID 101394519
(2R,3R)-1,4-diphenyl-1,2,3,4-tetrahydronaphthalene-2,3-dicarbonitrile (PubChem CID 101394519) has the molecular formula C24H18N2 and a molecular weight of 334.42 g/mol. Its IUPAC name is (2R,3R)-1,4-diphenyl-1,2,3,4-tetrahydronaphthalene-2,3-dicarbonitrile.
| Compound Name | (2R,3R)-1,4-diphenyl-1,2,3,4-tetrahydronaphthalene-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 101394519 |
| Molecular Formula | C24H18N2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (2R,3R)-1,4-diphenyl-1,2,3,4-tetrahydronaphthalene-2,3-dicarbonitrile |
| SMILES | N#C[C@@H]1C(c2ccccc2)c2ccccc2C(c2ccccc2)[C@H]1C#N |
| InChI | InChI=1S/C24H18N2/c25-15-21-22(16-26)24(18-11-5-2-6-12-18)20-14-8-7-13-19(20)23(21)17-9-3-1-4-10-17/h1-14,21-24H/t21-,22-,23?,24?/m0/s1 |
| InChIKey | ZDGMBTUJRMIATG-WOLZVPSQSA-N |
| XLogP | 5.24 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |