C9H8N2 — CID 13181977
(2R,3R)-3-phenylaziridine-2-carbonitrile (PubChem CID 13181977) has the molecular formula C9H8N2 and a molecular weight of 144.18 g/mol. Its IUPAC name is (2R,3R)-3-phenylaziridine-2-carbonitrile.
| Compound Name | (2R,3R)-3-phenylaziridine-2-carbonitrile |
|---|---|
| PubChem CID | 13181977 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | (2R,3R)-3-phenylaziridine-2-carbonitrile |
| SMILES | N#C[C@@H]1N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C9H8N2/c10-6-8-9(11-8)7-4-2-1-3-5-7/h1-5,8-9,11H/t8-,9+/m0/s1 |
| InChIKey | PBNPTRKEHUFRPP-DTWKUNHWSA-N |
| XLogP | 1.22 |
| TPSA | 45.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|