C9H11NO2 — CID 143371351
(3R,4S)-4-phenylazetidine-2,3-diol (PubChem CID 143371351) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is (3R,4S)-4-phenylazetidine-2,3-diol.
| Compound Name | (3R,4S)-4-phenylazetidine-2,3-diol |
|---|---|
| PubChem CID | 143371351 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (3R,4S)-4-phenylazetidine-2,3-diol |
| SMILES | OC1N[C@@H](c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C9H11NO2/c11-8-7(10-9(8)12)6-4-2-1-3-5-6/h1-5,7-12H/t7-,8+,9?/m0/s1 |
| InChIKey | VRBGZCFUKANPIE-ZQTLJVIJSA-N |
| XLogP | 0.01 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |