C10H9N — CID 6427548
trans-(1R,2S)-2-phenylcyclopropane-1-carbonitrile (PubChem CID 6427548) has the molecular formula C10H9N and a molecular weight of 143.19 g/mol. Its IUPAC name is trans-(1R,2S)-2-phenylcyclopropane-1-carbonitrile.
| Compound Name | trans-(1R,2S)-2-phenylcyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 6427548 |
| Molecular Formula | C10H9N |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | trans-(1R,2S)-2-phenylcyclopropane-1-carbonitrile |
| SMILES | N#C[C@@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C10H9N/c11-7-9-6-10(9)8-4-2-1-3-5-8/h1-5,9-10H,6H2/t9-,10+/m0/s1 |
| InChIKey | KUCVFITUDJTMFA-VHSXEESVSA-N |
| XLogP | 2.31 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |